آيسولوسين (صفحة بيانات)
{{OrganicBox complete
|wiki_name=آيسولوسين
|name=(2S,3S)-2-amino-3-methylpentanoic acid
| ============== GENERAL INFORMATION ===============
|C=6 | H=13 | N=1 | O=2
|mass=131.18 [1]
|abbreviation=I, Ile
|image=Chemical structure of IsoleucineChemical structure of Isoleucine
|synonyms={2/α}-amino-{3/β}-methylvaleric acid
3-methyl-{/erythro-}norvaline
Amino-sec-butyl-acetic acid
Amino(1-methylpropyl)-acetic acid
| =============== DATABASES ===============
|SMILES=CC[C@H](C)[C@@H](C(=O)O)N [1]
|InChI=1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/f/h8H [1]
|ATC_prefix=
|ATC_suffix=
|ATC_supplemental=
|CAS=73-32-5
|DrugBank=
|EINECS=200-798-2 [1]
|PubChem=6306
| =============== PHYSICAL PROPERTIES ===============
| --------------- Structure -------------
|index_of_refraction=
|abbe_number=
|dielectric_constant=
|magnetic_susceptibility=
|dipole_moment=
| ------------- U-V data --------------
|lambda_max=
|extinction_coefficient=
| ------------- Infrared data --------------
|absorbtion_bands=
| ------------- NMR data --------------
|proton_NMR=
|carbon_NMR=
|other_NMR=
| ------------- Spectrometry data --------------
|mass_spectrometry=
| -------- Phase behaviour -------
|delta_f_H_o=
|delta_fus_H_o=
|delta_fus_S_o=
|triple_point_K=
|triple_point_C=
|triple_point_Pa=
|criticle_point_K=
|criticle_point_C=
|criticle_point_Pa=
| ------- Solid properties -------
|S_o_solid=
|heat_capacity_solid=
|density_solid=
|melting_point_C=284
|melting_point_F=
|melting_point_K=
| ------- Liquid properties -------
|delta_vap_H_o=
|delta_vap_S_o=
|S_o_liquid=
|heat_capacity_liquid=
|density_liquid=
|viscosity_liquid=
|boiling_point_C=
|boiling_point_F=
|boiling_point_K=
| ------------- Gas properties --------------
|S_o_gas=
|heat_capacity_gas=
|viscosity_gas=
| ============== HAZARD PROPERTIES ===============
|MSDS=
|main_hazards=
|nfpa_health=
|nfpa_flammability=
|nfpa_reactivity=
|nfpa_special=
|flash_point=
|r_phrases=
|s_phrases=
|RTECS_number=
| ============== CHEMICAL PROPERTIES ===============
|XLogP=-1.743 [1]
|isoelectric_point=6.02
|disociation_constant=2.26; 9.60
|tautomers=
|H_bond_donor=2 [1]
|H_bond_acceptor=3 [1]
| ============== PHARMACOLOGICAL PROPERTIES ===============
|bioavailability=
|metabolism=
|elimination_half-life=
|excretion=
|pregnancy_category=
|legal_status=
|routes_of_administration=
}}
مصادر
المركبات الحيوية | العائلات الرئيسية من||
ببتيدات | الحموض الأمينية | حموض نووية | كاربوهيدرات | ليبيديات | تيربينات | كاروتينويدات | تيترابيرولات | عوامل مرافقة أنزيمية | ستيرويدات | فلافونيدات | قلويدات | بوليكيتيدات | غليكوزيدات | ||
Analogues of nucleic acids: | الأحماض الأمينية العشرين الأكثر إستخداماً | Analogues of nucleic acids: |
ألانين (ص.ب.) | أرجنين (ص.ب.) | أسباراجين (ص.ب.) | حمض الأسبارتيك (ص.ب.) | سيستئين (ص.ب.) | حمض الجلوتاميك (ص.ب.) | جلوتامين (ص.ب.) | جليسين (ص.ب.) | هيستيدين (ص.ب.) | آيسولوسين (ص.ب.) | لوسين (ص.ب.) | ليسين (ص.ب.) | ميثيونين (ص.ب.) | فينيلألانين (ص.ب.) | برولين (ص.ب.) | سيرين (ص.ب.) | ثريونين (ص.ب.) | تريبتوفان (ص.ب.) | تيروسين (ص.ب.) | فالين (ص.ب.) |
Isoleucine (data page)]]